C23H27N5 — CID 146555155
5-[(2R,6S)-2-imidazo[1,2-a]pyridin-2-yl-6-(3-methyl-2-pyridinyl)piperidin-1-yl]pentanenitrile (PubChem CID 146555155) has the molecular formula C23H27N5 and a molecular weight of 373.50 g/mol. Its IUPAC name is 5-[(2R,6S)-2-imidazo[1,2-a]pyridin-2-yl-6-(3-methyl-2-pyridinyl)piperidin-1-yl]pentanenitrile.
| Compound Name | 5-[(2R,6S)-2-imidazo[1,2-a]pyridin-2-yl-6-(3-methyl-2-pyridinyl)piperidin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 146555155 |
| Molecular Formula | C23H27N5 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 5-[(2R,6S)-2-imidazo[1,2-a]pyridin-2-yl-6-(3-methyl-2-pyridinyl)piperidin-1-yl]pentanenitrile |
| SMILES | Cc1cccnc1[C@@H]1CCC[C@H](c2cn3ccccc3n2)N1CCCCC#N |
| InChI | InChI=1S/C23H27N5/c1-18-9-8-14-25-23(18)21-11-7-10-20(28(21)16-5-2-4-13-24)19-17-27-15-6-3-12-22(27)26-19/h3,6,8-9,12,14-15,17,20-21H,2,4-5,7,10-11,16H2,1H3/t20-,21+/m1/s1 |
| InChIKey | JPJHOUUFVWALSF-RTWAWAEBSA-N |
| XLogP | 5.00 |
| TPSA | 57.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|