About ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate
ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate (PubChem CID 162531820) has the molecular formula C20H25N3O2
and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate |
| PubChem CID | 162531820 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc([C@H]2CCC[C@@H](c3ncccc3C)N2C)n1 |
| InChI | InChI=1S/C20H25N3O2/c1-4-25-20(24)16-10-5-9-15(22-16)17-11-6-12-18(23(17)3)19-14(2)8-7-13-21-19/h5,7-10,13,17-18H,4,6,11-12H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | WEMIRFTYGRBUCI-MSOLQXFVSA-N |
| XLogP | 3.86 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate?
The IUPAC name of ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate (CID 162531820) is ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate?
The canonical SMILES for ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate is CCOC(=O)c1cccc([C@H]2CCC[C@@H](c3ncccc3C)N2C)n1.
What is the InChIKey of ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate?
The InChIKey is WEMIRFTYGRBUCI-MSOLQXFVSA-N. The full InChI is InChI=1S/C20H25N3O2/c1-4-25-20(24)16-10-5-9-15(22-16)17-11-6-12-18(23(17)3)19-14(2)8-7-13-21-19/h5,7-10,13,17-18H,4,6,11-12H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate?
ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate has a molecular weight of 339.44 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]pyridine-2-carboxylate is sourced from PubChem (CID 162531820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).