C25H32N4O2 — CID 155453416
tert-butyl N-[3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]-3-pyridinyl]prop-2-ynyl]carbamate (PubChem CID 155453416) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]-3-pyridinyl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]-3-pyridinyl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 155453416 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | tert-butyl N-[3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]-3-pyridinyl]prop-2-ynyl]carbamate |
| SMILES | Cc1cccnc1[C@@H]1CCC[C@H](c2ncccc2C#CCNC(=O)OC(C)(C)C)N1C |
| InChI | InChI=1S/C25H32N4O2/c1-18-10-7-15-26-22(18)20-13-6-14-21(29(20)5)23-19(11-8-16-27-23)12-9-17-28-24(30)31-25(2,3)4/h7-8,10-11,15-16,20-21H,6,13-14,17H2,1-5H3,(H,28,30)/t20-,21+/m0/s1 |
| InChIKey | BUNHXGHANSKBQH-LEWJYISDSA-N |
| XLogP | 4.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|