C24H32N4O4 — CID 166909965
tert-butyl (6S)-2-[6-[methoxy(methyl)carbamoyl]-2-pyridinyl]-6-(3-methyl-2-pyridinyl)piperidine-1-carboxylate (PubChem CID 166909965) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is tert-butyl (6S)-2-[6-[methoxy(methyl)carbamoyl]-2-pyridinyl]-6-(3-methyl-2-pyridinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (6S)-2-[6-[methoxy(methyl)carbamoyl]-2-pyridinyl]-6-(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166909965 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl (6S)-2-[6-[methoxy(methyl)carbamoyl]-2-pyridinyl]-6-(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
| SMILES | CON(C)C(=O)c1cccc(C2CCC[C@@H](c3ncccc3C)N2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C24H32N4O4/c1-16-10-9-15-25-21(16)20-14-8-13-19(28(20)23(30)32-24(2,3)4)17-11-7-12-18(26-17)22(29)27(5)31-6/h7,9-12,15,19-20H,8,13-14H2,1-6H3/t19?,20-/m0/s1 |
| InChIKey | DMVILSUYXNHNSH-ANYOKISRSA-N |
| XLogP | 4.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|