C20H32N4O2 — CID 155453348
tert-butyl N-[[1-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]ethenylamino]methyl]carbamate (PubChem CID 155453348) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is tert-butyl N-[[1-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]ethenylamino]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]ethenylamino]methyl]carbamate |
|---|---|
| PubChem CID | 155453348 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | tert-butyl N-[[1-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]ethenylamino]methyl]carbamate |
| SMILES | C=C(NCNC(=O)OC(C)(C)C)[C@H]1CCC[C@@H](c2ncccc2C)N1C |
| InChI | InChI=1S/C20H32N4O2/c1-14-9-8-12-21-18(14)17-11-7-10-16(24(17)6)15(2)22-13-23-19(25)26-20(3,4)5/h8-9,12,16-17,22H,2,7,10-11,13H2,1,3-6H3,(H,23,25)/t16-,17+/m1/s1 |
| InChIKey | DXSLVSKEVLQGPG-SJORKVTESA-N |
| XLogP | 3.50 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|