C19H18F2N4O — CID 146557150
3-fluoro-2-[4-[(3R,5R)-5-fluoropiperidin-3-yl]phenyl]indazole-7-carboxamide (PubChem CID 146557150) has the molecular formula C19H18F2N4O and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-fluoro-2-[4-[(3R,5R)-5-fluoropiperidin-3-yl]phenyl]indazole-7-carboxamide.
| Compound Name | 3-fluoro-2-[4-[(3R,5R)-5-fluoropiperidin-3-yl]phenyl]indazole-7-carboxamide |
|---|---|
| PubChem CID | 146557150 |
| Molecular Formula | C19H18F2N4O |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-fluoro-2-[4-[(3R,5R)-5-fluoropiperidin-3-yl]phenyl]indazole-7-carboxamide |
| SMILES | NC(=O)c1cccc2c(F)n(-c3ccc([C@@H]4CNC[C@H](F)C4)cc3)nc12 |
| InChI | InChI=1S/C19H18F2N4O/c20-13-8-12(9-23-10-13)11-4-6-14(7-5-11)25-18(21)15-2-1-3-16(19(22)26)17(15)24-25/h1-7,12-13,23H,8-10H2,(H2,22,26)/t12-,13+/m0/s1 |
| InChIKey | YEHLSULLNGRSJX-QWHCGFSZSA-N |
| XLogP | 2.68 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |