C28H26ClN5 — CID 146559091
8-chloro-6-[[(Z,3R)-4-methylidene-7-methyliminohept-5-en-1-yn-3-yl]amino]-4-[[(1R)-1-phenylpropyl]amino]quinoline-3-carbonitrile (PubChem CID 146559091) has the molecular formula C28H26ClN5 and a molecular weight of 468.00 g/mol. Its IUPAC name is 8-chloro-6-[[(Z,3R)-4-methylidene-7-methyliminohept-5-en-1-yn-3-yl]amino]-4-[[(1R)-1-phenylpropyl]amino]quinoline-3-carbonitrile.
| Compound Name | 8-chloro-6-[[(Z,3R)-4-methylidene-7-methyliminohept-5-en-1-yn-3-yl]amino]-4-[[(1R)-1-phenylpropyl]amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 146559091 |
| Molecular Formula | C28H26ClN5 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 8-chloro-6-[[(Z,3R)-4-methylidene-7-methyliminohept-5-en-1-yn-3-yl]amino]-4-[[(1R)-1-phenylpropyl]amino]quinoline-3-carbonitrile |
| SMILES | C#C[C@@H](Nc1cc(Cl)c2ncc(C#N)c(N[C@H](CC)c3ccccc3)c2c1)C(=C)/C=C\C=N\C |
| InChI | InChI=1S/C28H26ClN5/c1-5-25(19(3)11-10-14-31-4)33-22-15-23-27(21(17-30)18-32-28(23)24(29)16-22)34-26(6-2)20-12-8-7-9-13-20/h1,7-16,18,25-26,33H,3,6H2,2,4H3,(H,32,34)/b11-10-,31-14+/t25-,26-/m1/s1 |
| InChIKey | QMJOSIAIICTLRH-FKLRTBTLSA-N |
| XLogP | 6.55 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|