C19H16ClFN4 — CID 145229955
6-amino-8-chloro-4-[(3-fluoro-1-phenylpropyl)amino]quinoline-3-carbonitrile (PubChem CID 145229955) has the molecular formula C19H16ClFN4 and a molecular weight of 354.82 g/mol. Its IUPAC name is 6-amino-8-chloro-4-[(3-fluoro-1-phenylpropyl)amino]quinoline-3-carbonitrile.
| Compound Name | 6-amino-8-chloro-4-[(3-fluoro-1-phenylpropyl)amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 145229955 |
| Molecular Formula | C19H16ClFN4 |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-amino-8-chloro-4-[(3-fluoro-1-phenylpropyl)amino]quinoline-3-carbonitrile |
| SMILES | N#Cc1cnc2c(Cl)cc(N)cc2c1NC(CCF)c1ccccc1 |
| InChI | InChI=1S/C19H16ClFN4/c20-16-9-14(23)8-15-18(13(10-22)11-24-19(15)16)25-17(6-7-21)12-4-2-1-3-5-12/h1-5,8-9,11,17H,6-7,23H2,(H,24,25) |
| InChIKey | ZTWVXQOEOPSLEN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|