C20H17ClN4O3S — CID 145229893
8-chloro-4-[(3-methylsulfanyloxy-1-phenylpropyl)amino]-6-nitroquinoline-3-carbonitrile (PubChem CID 145229893) has the molecular formula C20H17ClN4O3S and a molecular weight of 428.90 g/mol. Its IUPAC name is 8-chloro-4-[(3-methylsulfanyloxy-1-phenylpropyl)amino]-6-nitroquinoline-3-carbonitrile.
| Compound Name | 8-chloro-4-[(3-methylsulfanyloxy-1-phenylpropyl)amino]-6-nitroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 145229893 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 8-chloro-4-[(3-methylsulfanyloxy-1-phenylpropyl)amino]-6-nitroquinoline-3-carbonitrile |
| SMILES | CSOCCC(Nc1c(C#N)cnc2c(Cl)cc([N+](=O)[O-])cc12)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN4O3S/c1-29-28-8-7-18(13-5-3-2-4-6-13)24-19-14(11-22)12-23-20-16(19)9-15(25(26)27)10-17(20)21/h2-6,9-10,12,18H,7-8H2,1H3,(H,23,24) |
| InChIKey | DDJVTUWSIRZKOX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|