C7H10FN — CID 146561026
5-fluoro-3,6-dimethyl-2,3-dihydropyridine (PubChem CID 146561026) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 5-fluoro-3,6-dimethyl-2,3-dihydropyridine.
| Compound Name | 5-fluoro-3,6-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 146561026 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 5-fluoro-3,6-dimethyl-2,3-dihydropyridine |
| SMILES | CC1=NCC(C)C=C1F |
| InChI | InChI=1S/C7H10FN/c1-5-3-7(8)6(2)9-4-5/h3,5H,4H2,1-2H3 |
| InChIKey | DHAIKPCGTABERR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |