C6H7F2N — CID 90697100
5,6-difluoro-3-methyl-2,3-dihydropyridine (PubChem CID 90697100) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is 5,6-difluoro-3-methyl-2,3-dihydropyridine.
| Compound Name | 5,6-difluoro-3-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 90697100 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 5,6-difluoro-3-methyl-2,3-dihydropyridine |
| SMILES | CC1C=C(F)C(F)=NC1 |
| InChI | InChI=1S/C6H7F2N/c1-4-2-5(7)6(8)9-3-4/h2,4H,3H2,1H3 |
| InChIKey | CPPWPTKBXNAOGP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |