C5H3F4N — CID 163501932
2,3,5,6-tetrafluoro-2,3-dihydropyridine (PubChem CID 163501932) has the molecular formula C5H3F4N and a molecular weight of 153.08 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-2,3-dihydropyridine.
| Compound Name | 2,3,5,6-tetrafluoro-2,3-dihydropyridine |
|---|---|
| PubChem CID | 163501932 |
| Molecular Formula | C5H3F4N |
| Molecular Weight | 153.08 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-2,3-dihydropyridine |
| SMILES | FC1=CC(F)C(F)N=C1F |
| InChI | InChI=1S/C5H3F4N/c6-2-1-3(7)5(9)10-4(2)8/h1-2,4H |
| InChIKey | CVMQIWCQWNTTBN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.08 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|