C19H30N2O2 — CID 146564499
5-hydroxy-N-(2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl)pentanamide (PubChem CID 146564499) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5-hydroxy-N-(2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl)pentanamide.
| Compound Name | 5-hydroxy-N-(2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl)pentanamide |
|---|---|
| PubChem CID | 146564499 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 5-hydroxy-N-(2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl)pentanamide |
| SMILES | CC(C)N1c2cc(NC(=O)CCCCO)ccc2C(C)(C)C1C |
| InChI | InChI=1S/C19H30N2O2/c1-13(2)21-14(3)19(4,5)16-10-9-15(12-17(16)21)20-18(23)8-6-7-11-22/h9-10,12-14,22H,6-8,11H2,1-5H3,(H,20,23) |
| InChIKey | KKGDITIZNLCJGP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|