C18H27NO — CID 146568600
(E,6E)-6-[3-(3,4-dihydro-2H-pyran-5-yl)cyclohex-2-en-1-ylidene]-3-methylhex-2-en-1-amine (PubChem CID 146568600) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (E,6E)-6-[3-(3,4-dihydro-2H-pyran-5-yl)cyclohex-2-en-1-ylidene]-3-methylhex-2-en-1-amine.
| Compound Name | (E,6E)-6-[3-(3,4-dihydro-2H-pyran-5-yl)cyclohex-2-en-1-ylidene]-3-methylhex-2-en-1-amine |
|---|---|
| PubChem CID | 146568600 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (E,6E)-6-[3-(3,4-dihydro-2H-pyran-5-yl)cyclohex-2-en-1-ylidene]-3-methylhex-2-en-1-amine |
| SMILES | C/C(=C\CN)CC/C=C1/C=C(C2=COCCC2)CCC1 |
| InChI | InChI=1S/C18H27NO/c1-15(10-11-19)5-2-6-16-7-3-8-17(13-16)18-9-4-12-20-14-18/h6,10,13-14H,2-5,7-9,11-12,19H2,1H3/b15-10+,16-6+ |
| InChIKey | NPMGJESSQPUQLZ-YPBSEQFOSA-N |
| XLogP | 4.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|