C13H8F2N2 — CID 146569239
2-(4-amino-3,5-difluorophenyl)benzonitrile (PubChem CID 146569239) has the molecular formula C13H8F2N2 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-(4-amino-3,5-difluorophenyl)benzonitrile.
| Compound Name | 2-(4-amino-3,5-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 146569239 |
| Molecular Formula | C13H8F2N2 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-(4-amino-3,5-difluorophenyl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C13H8F2N2/c14-11-5-9(6-12(15)13(11)17)10-4-2-1-3-8(10)7-16/h1-6H,17H2 |
| InChIKey | MXDRTTHLIJHHGP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|