C18H34O4 — CID 146570273
(3R,4S)-4-tert-butyl-2-[2-(3-methoxyoxan-4-yl)propyl]oxan-3-ol (PubChem CID 146570273) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3R,4S)-4-tert-butyl-2-[2-(3-methoxyoxan-4-yl)propyl]oxan-3-ol.
| Compound Name | (3R,4S)-4-tert-butyl-2-[2-(3-methoxyoxan-4-yl)propyl]oxan-3-ol |
|---|---|
| PubChem CID | 146570273 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (3R,4S)-4-tert-butyl-2-[2-(3-methoxyoxan-4-yl)propyl]oxan-3-ol |
| SMILES | COC1COCCC1C(C)CC1OCC[C@@H](C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C18H34O4/c1-12(13-6-8-21-11-16(13)20-5)10-15-17(19)14(7-9-22-15)18(2,3)4/h12-17,19H,6-11H2,1-5H3/t12?,13?,14-,15?,16?,17-/m1/s1 |
| InChIKey | AYDQAZCOMXQACE-QXEBHSJCSA-N |
| XLogP | 2.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |