C7H14OS — CID 146570954
trans-(1S,3S)-3-methoxycyclohexane-1-thiol (PubChem CID 146570954) has the molecular formula C7H14OS and a molecular weight of 146.25 g/mol. Its IUPAC name is trans-(1S,3S)-3-methoxycyclohexane-1-thiol.
| Compound Name | trans-(1S,3S)-3-methoxycyclohexane-1-thiol |
|---|---|
| PubChem CID | 146570954 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | trans-(1S,3S)-3-methoxycyclohexane-1-thiol |
| SMILES | CO[C@H]1CCC[C@H](S)C1 |
| InChI | InChI=1S/C7H14OS/c1-8-6-3-2-4-7(9)5-6/h6-7,9H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | UJKBIIRQVNFDGG-BQBZGAKWSA-N |
| XLogP | 1.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|