C39H24N4S — CID 146572632
9-[4-(3-dibenzothiophen-3-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 146572632) has the molecular formula C39H24N4S and a molecular weight of 580.72 g/mol. Its IUPAC name is 9-[4-(3-dibenzothiophen-3-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-(3-dibenzothiophen-3-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 146572632 |
| Molecular Formula | C39H24N4S |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 9-[4-(3-dibenzothiophen-3-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4ccc5c(c4)sc4ccccc45)c3)nc(-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C39H24N4S/c1-2-11-25(12-3-1)37-40-38(42-39(41-37)43-33-18-7-4-15-29(33)30-16-5-8-19-34(30)43)28-14-10-13-26(23-28)27-21-22-32-31-17-6-9-20-35(31)44-36(32)24-27/h1-24H |
| InChIKey | FEECQCXUMPXILP-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |