C51H30N4O2 — CID 146572654
4-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole (PubChem CID 146572654) has the molecular formula C51H30N4O2 and a molecular weight of 730.83 g/mol. Its IUPAC name is 4-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole.
| Compound Name | 4-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 146572654 |
| Molecular Formula | C51H30N4O2 |
| Molecular Weight | 730.83 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | 4-[3-[4,6-di(dibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
| SMILES | c1ccc(-n2c3ccccc3c3c(-c4cccc(-c5nc(-c6ccc7c(c6)oc6ccccc67)nc(-c6ccc7c(c6)oc6ccccc67)n5)c4)cccc32)cc1 |
| InChI | InChI=1S/C51H30N4O2/c1-2-14-35(15-3-1)55-42-20-7-4-18-41(42)48-36(19-11-21-43(48)55)31-12-10-13-32(28-31)49-52-50(33-24-26-39-37-16-5-8-22-44(37)56-46(39)29-33)54-51(53-49)34-25-27-40-38-17-6-9-23-45(38)57-47(40)30-34/h1-30H |
| InChIKey | ZGSIYQHDSHPPPG-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.83 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |