C51H36BN4O- — CID 159052403
boranuide;4-[3-[4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole (PubChem CID 159052403) has the molecular formula C51H36BN4O- and a molecular weight of 731.69 g/mol. Its IUPAC name is boranuide;4-[3-[4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole.
| Compound Name | boranuide;4-[3-[4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 159052403 |
| Molecular Formula | C51H36BN4O- |
| Molecular Weight | 731.69 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | boranuide;4-[3-[4-(3-dibenzofuran-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-9-phenylcarbazole |
| SMILES | [BH4-].c1ccc(-c2nc(-c3cccc(-c4cccc5c4oc4ccccc45)c3)nc(-c3cccc(-c4cccc5c4c4ccccc4n5-c4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C51H32N4O.BH4/c1-3-15-33(16-4-1)49-52-50(54-51(53-49)37-20-12-18-35(32-37)40-26-13-27-42-41-23-8-10-30-46(41)56-48(40)42)36-19-11-17-34(31-36)39-25-14-29-45-47(39)43-24-7-9-28-44(43)55(45)38-21-5-2-6-22-38;/h1-32H;1H4/q;-1 |
| InChIKey | JXKUNXJSKSVOKL-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.69 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|