C23H31FN2O2 — CID 146580621
2-[(E,3Z)-3-[(2Z)-2-ethylidene-4-methylcyclohexylidene]prop-1-enyl]-5-[(2Z,5Z)-6-fluoro-5-propan-2-yloxyhexa-2,5-dienyl]-1,3,4-oxadiazole (PubChem CID 146580621) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-[(E,3Z)-3-[(2Z)-2-ethylidene-4-methylcyclohexylidene]prop-1-enyl]-5-[(2Z,5Z)-6-fluoro-5-propan-2-yloxyhexa-2,5-dienyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(E,3Z)-3-[(2Z)-2-ethylidene-4-methylcyclohexylidene]prop-1-enyl]-5-[(2Z,5Z)-6-fluoro-5-propan-2-yloxyhexa-2,5-dienyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 146580621 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 2-[(E,3Z)-3-[(2Z)-2-ethylidene-4-methylcyclohexylidene]prop-1-enyl]-5-[(2Z,5Z)-6-fluoro-5-propan-2-yloxyhexa-2,5-dienyl]-1,3,4-oxadiazole |
| SMILES | C/C=C1/CC(C)CC/C1=C/C=C/c1nnc(C/C=C\C/C(=C/F)OC(C)C)o1 |
| InChI | InChI=1S/C23H31FN2O2/c1-5-19-15-18(4)13-14-20(19)9-8-12-23-26-25-22(28-23)11-7-6-10-21(16-24)27-17(2)3/h5-9,12,16-18H,10-11,13-15H2,1-4H3/b7-6-,12-8+,19-5-,20-9-,21-16- |
| InChIKey | MXRUBGDGHNPZEN-NKOYGMBVSA-N |
| XLogP | 6.50 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|