C55H42N4 — CID 146581337
N-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-methylphenyl)-9,9'-spirobi[fluorene]-2'-amine (PubChem CID 146581337) has the molecular formula C55H42N4 and a molecular weight of 758.97 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-methylphenyl)-9,9'-spirobi[fluorene]-2'-amine.
| Compound Name | N-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-methylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
|---|---|
| PubChem CID | 146581337 |
| Molecular Formula | C55H42N4 |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 758.34 |
| IUPAC Name | N-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N-(4-methylphenyl)-9,9'-spirobi[fluorene]-2'-amine |
| SMILES | Cc1ccc(N(C2=CCC(C)(C)C=C2)c2ccc3c(c2)C2(c4ccccc4-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc42)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C55H42N4/c1-36-22-25-40(26-23-36)59(41-30-32-54(2,3)33-31-41)42-27-29-46-44-19-11-13-21-48(44)55(50(46)35-42)47-20-12-10-18-43(47)45-28-24-39(34-49(45)55)53-57-51(37-14-6-4-7-15-37)56-52(58-53)38-16-8-5-9-17-38/h4-32,34-35H,33H2,1-3H3 |
| InChIKey | HUTYITAKISNPMC-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |