C54H40N4 — CID 70854334
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-amine (PubChem CID 70854334) has the molecular formula C54H40N4 and a molecular weight of 744.94 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-amine.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-amine |
|---|---|
| PubChem CID | 70854334 |
| Molecular Formula | C54H40N4 |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-bis(4-methylphenyl)spiro[3,4-dihydrofluorene-9,9'-fluorene]-2'-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)C2(C4=C(CCC(c5nc(-c6ccccc6)nc(-c6ccccc6)n5)=C4)c4ccccc42)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C54H40N4/c1-35-21-26-40(27-22-35)58(41-28-23-36(2)24-29-41)42-30-32-46-44-18-10-12-20-48(44)54(50(46)34-42)47-19-11-9-17-43(47)45-31-25-39(33-49(45)54)53-56-51(37-13-5-3-6-14-37)55-52(57-53)38-15-7-4-8-16-38/h3-24,26-30,32-34H,25,31H2,1-2H3 |
| InChIKey | FMLDRIPQULLBQD-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |