C27H44N2O5S — CID 146582181
1-[2-[4-[(1R,3R)-3-ethyl-3-hex-5-en-3-ylperoxycyclohexyl]phenoxy]ethyl]-4-methylsulfonylpiperazine (PubChem CID 146582181) has the molecular formula C27H44N2O5S and a molecular weight of 508.73 g/mol. Its IUPAC name is 1-[2-[4-[(1R,3R)-3-ethyl-3-hex-5-en-3-ylperoxycyclohexyl]phenoxy]ethyl]-4-methylsulfonylpiperazine.
| Compound Name | 1-[2-[4-[(1R,3R)-3-ethyl-3-hex-5-en-3-ylperoxycyclohexyl]phenoxy]ethyl]-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 146582181 |
| Molecular Formula | C27H44N2O5S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 1-[2-[4-[(1R,3R)-3-ethyl-3-hex-5-en-3-ylperoxycyclohexyl]phenoxy]ethyl]-4-methylsulfonylpiperazine |
| SMILES | C=CCC(CC)OO[C@]1(CC)CCC[C@@H](c2ccc(OCCN3CCN(S(C)(=O)=O)CC3)cc2)C1 |
| InChI | InChI=1S/C27H44N2O5S/c1-5-9-25(6-2)33-34-27(7-3)15-8-10-24(22-27)23-11-13-26(14-12-23)32-21-20-28-16-18-29(19-17-28)35(4,30)31/h5,11-14,24-25H,1,6-10,15-22H2,2-4H3/t24-,25?,27-/m1/s1 |
| InChIKey | XMYWJYWJVYGFFX-PTYBVJFYSA-N |
| XLogP | 4.75 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|