C23H27ClN2O3 — CID 146583918
4-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]-3-benzyl-4-oxobutanoic acid (PubChem CID 146583918) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is 4-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]-3-benzyl-4-oxobutanoic acid.
| Compound Name | 4-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]-3-benzyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 146583918 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]-3-benzyl-4-oxobutanoic acid |
| SMILES | N[C@@]1(Cc2ccc(Cl)cc2)CCCN(C(=O)C(CC(=O)O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H27ClN2O3/c24-20-9-7-18(8-10-20)15-23(25)11-4-12-26(16-23)22(29)19(14-21(27)28)13-17-5-2-1-3-6-17/h1-3,5-10,19H,4,11-16,25H2,(H,27,28)/t19?,23-/m1/s1 |
| InChIKey | RIRFXLRRUMUHEX-LEQGEALCSA-N |
| XLogP | 3.54 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |