C21H26ClN3O4 — CID 156777867
(3R)-3-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]oxy-4-(1-oxidopyridin-1-ium-2-yl)butanoic acid (PubChem CID 156777867) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is (3R)-3-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]oxy-4-(1-oxidopyridin-1-ium-2-yl)butanoic acid.
| Compound Name | (3R)-3-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]oxy-4-(1-oxidopyridin-1-ium-2-yl)butanoic acid |
|---|---|
| PubChem CID | 156777867 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3R)-3-[(3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidin-1-yl]oxy-4-(1-oxidopyridin-1-ium-2-yl)butanoic acid |
| SMILES | N[C@@]1(Cc2ccc(Cl)cc2)CCCN(O[C@@H](CC(=O)O)Cc2cccc[n+]2[O-])C1 |
| InChI | InChI=1S/C21H26ClN3O4/c22-17-7-5-16(6-8-17)14-21(23)9-3-10-24(15-21)29-19(13-20(26)27)12-18-4-1-2-11-25(18)28/h1-2,4-8,11,19H,3,9-10,12-15,23H2,(H,26,27)/t19-,21-/m1/s1 |
| InChIKey | UCAGMHZEYNVANB-TZIWHRDSSA-N |
| XLogP | 2.33 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|