C10H12ClNO3 — CID 146585189
[(1R)-1-(4-chlorophenyl)-2-hydroxyethyl]-methylcarbamic acid (PubChem CID 146585189) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2-hydroxyethyl]-methylcarbamic acid.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2-hydroxyethyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 146585189 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2-hydroxyethyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@@H](CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO3/c1-12(10(14)15)9(6-13)7-2-4-8(11)5-3-7/h2-5,9,13H,6H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | LRGUMDLPAQUIJT-VIFPVBQESA-N |
| XLogP | 1.98 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |