C13H15FN4O3 — CID 146586808
[(4S)-4-(3-amino-4-fluorophenyl)-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid (PubChem CID 146586808) has the molecular formula C13H15FN4O3 and a molecular weight of 294.29 g/mol. Its IUPAC name is [(4S)-4-(3-amino-4-fluorophenyl)-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid.
| Compound Name | [(4S)-4-(3-amino-4-fluorophenyl)-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146586808 |
| Molecular Formula | C13H15FN4O3 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | [(4S)-4-(3-amino-4-fluorophenyl)-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
| SMILES | CN1C(=O)C[C@@](C)(c2ccc(F)c(N)c2)N=C1NC(=O)O |
| InChI | InChI=1S/C13H15FN4O3/c1-13(7-3-4-8(14)9(15)5-7)6-10(19)18(2)11(17-13)16-12(20)21/h3-5H,6,15H2,1-2H3,(H,16,17)(H,20,21)/t13-/m0/s1 |
| InChIKey | VOILQKUTBQYDHZ-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|