C19H15ClF3N5O5 — CID 146586769
[(4S)-4-[3-(5-chloro-2-nitroanilino)-2,4,6-trifluorophenyl]-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid (PubChem CID 146586769) has the molecular formula C19H15ClF3N5O5 and a molecular weight of 485.81 g/mol. Its IUPAC name is [(4S)-4-[3-(5-chloro-2-nitroanilino)-2,4,6-trifluorophenyl]-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid.
| Compound Name | [(4S)-4-[3-(5-chloro-2-nitroanilino)-2,4,6-trifluorophenyl]-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146586769 |
| Molecular Formula | C19H15ClF3N5O5 |
| Molecular Weight | 485.81 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | [(4S)-4-[3-(5-chloro-2-nitroanilino)-2,4,6-trifluorophenyl]-1,4-dimethyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
| SMILES | CN1C(=O)C[C@@](C)(c2c(F)cc(F)c(Nc3cc(Cl)ccc3[N+](=O)[O-])c2F)N=C1NC(=O)O |
| InChI | InChI=1S/C19H15ClF3N5O5/c1-19(7-13(29)27(2)17(26-19)25-18(30)31)14-9(21)6-10(22)16(15(14)23)24-11-5-8(20)3-4-12(11)28(32)33/h3-6,24H,7H2,1-2H3,(H,25,26)(H,30,31)/t19-/m0/s1 |
| InChIKey | RZUWIXYWENWCAJ-IBGZPJMESA-N |
| XLogP | 4.11 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|