C28H22N4 — CID 146586999
2-[3-(2,5-dimethyl-4-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146586999) has the molecular formula C28H22N4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[3-(2,5-dimethyl-4-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-(2,5-dimethyl-4-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146586999 |
| Molecular Formula | C28H22N4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[3-(2,5-dimethyl-4-pyridinyl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc(-c2cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2)c(C)cn1 |
| InChI | InChI=1S/C28H22N4/c1-19-18-29-20(2)16-25(19)23-14-9-15-24(17-23)28-31-26(21-10-5-3-6-11-21)30-27(32-28)22-12-7-4-8-13-22/h3-18H,1-2H3 |
| InChIKey | CKTNUTNAHDGUSP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |