C21H28N12S2 — CID 146588690
2-N-[2-[4-[[4-amino-6-[methyl(2-thiophen-2-ylethyl)amino]-1,3,5-triazin-2-yl]amino]thiophen-2-yl]ethyl]-2-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 146588690) has the molecular formula C21H28N12S2 and a molecular weight of 512.67 g/mol. Its IUPAC name is 2-N-[2-[4-[[4-amino-6-[methyl(2-thiophen-2-ylethyl)amino]-1,3,5-triazin-2-yl]amino]thiophen-2-yl]ethyl]-2-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[4-[[4-amino-6-[methyl(2-thiophen-2-ylethyl)amino]-1,3,5-triazin-2-yl]amino]thiophen-2-yl]ethyl]-2-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146588690 |
| Molecular Formula | C21H28N12S2 |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 2-N-[2-[4-[[4-amino-6-[methyl(2-thiophen-2-ylethyl)amino]-1,3,5-triazin-2-yl]amino]thiophen-2-yl]ethyl]-2-N,4-N-dimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(N)nc(N(C)CCc2cc(Nc3nc(N)nc(N(C)CCc4cccs4)n3)cs2)n1 |
| InChI | InChI=1S/C21H28N12S2/c1-24-18-26-16(22)28-20(30-18)33(3)9-7-15-11-13(12-35-15)25-19-27-17(23)29-21(31-19)32(2)8-6-14-5-4-10-34-14/h4-5,10-12H,6-9H2,1-3H3,(H3,22,24,26,28,30)(H3,23,25,27,29,31) |
| InChIKey | MLEZJAONNNGZDD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |