C27H23N3O4 — CID 146591605
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-pyrazol-1-ylphenyl)propanoic acid (PubChem CID 146591605) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-pyrazol-1-ylphenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-pyrazol-1-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 146591605 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-pyrazol-1-ylphenyl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(-n2cccn2)cc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H23N3O4/c31-26(32)25(16-18-10-12-19(13-11-18)30-15-5-14-28-30)29-27(33)34-17-24-22-8-3-1-6-20(22)21-7-2-4-9-23(21)24/h1-15,24-25H,16-17H2,(H,29,33)(H,31,32) |
| InChIKey | ZZHMOKPAGALFRS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |