C20H21ClO4 — CID 146594268
methyl 4-[4-(4-chlorobenzoyl)phenoxy]-2,3-dimethylbutanoate (PubChem CID 146594268) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is methyl 4-[4-(4-chlorobenzoyl)phenoxy]-2,3-dimethylbutanoate.
| Compound Name | methyl 4-[4-(4-chlorobenzoyl)phenoxy]-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 146594268 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl 4-[4-(4-chlorobenzoyl)phenoxy]-2,3-dimethylbutanoate |
| SMILES | COC(=O)C(C)C(C)COc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H21ClO4/c1-13(14(2)20(23)24-3)12-25-18-10-6-16(7-11-18)19(22)15-4-8-17(21)9-5-15/h4-11,13-14H,12H2,1-3H3 |
| InChIKey | HPJINEKIYRHJCN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |