C15H21BrO3 — CID 146594299
propan-2-yl 4-(4-bromophenoxy)-2,3-dimethylbutanoate (PubChem CID 146594299) has the molecular formula C15H21BrO3 and a molecular weight of 329.23 g/mol. Its IUPAC name is propan-2-yl 4-(4-bromophenoxy)-2,3-dimethylbutanoate.
| Compound Name | propan-2-yl 4-(4-bromophenoxy)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 146594299 |
| Molecular Formula | C15H21BrO3 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | propan-2-yl 4-(4-bromophenoxy)-2,3-dimethylbutanoate |
| SMILES | CC(C)OC(=O)C(C)C(C)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrO3/c1-10(2)19-15(17)12(4)11(3)9-18-14-7-5-13(16)6-8-14/h5-8,10-12H,9H2,1-4H3 |
| InChIKey | ZNPNXAJBVJTFGK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |