C14H19FO3 — CID 146594312
ethyl (3S,4R)-4-(4-fluorophenoxy)-3-methylpentanoate (PubChem CID 146594312) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(4-fluorophenoxy)-3-methylpentanoate.
| Compound Name | ethyl (3S,4R)-4-(4-fluorophenoxy)-3-methylpentanoate |
|---|---|
| PubChem CID | 146594312 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethyl (3S,4R)-4-(4-fluorophenoxy)-3-methylpentanoate |
| SMILES | CCOC(=O)C[C@H](C)[C@@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FO3/c1-4-17-14(16)9-10(2)11(3)18-13-7-5-12(15)6-8-13/h5-8,10-11H,4,9H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | JLHOINFSUCNRMD-WDEREUQCSA-N |
| XLogP | 3.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |