C17H26O3 — CID 146594320
propan-2-yl 4-(2,5-dimethylphenoxy)-3-methylpentanoate (PubChem CID 146594320) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is propan-2-yl 4-(2,5-dimethylphenoxy)-3-methylpentanoate.
| Compound Name | propan-2-yl 4-(2,5-dimethylphenoxy)-3-methylpentanoate |
|---|---|
| PubChem CID | 146594320 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | propan-2-yl 4-(2,5-dimethylphenoxy)-3-methylpentanoate |
| SMILES | Cc1ccc(C)c(OC(C)C(C)CC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-11(2)19-17(18)10-14(5)15(6)20-16-9-12(3)7-8-13(16)4/h7-9,11,14-15H,10H2,1-6H3 |
| InChIKey | ARZHCTFMBMYRIE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |