C23H31NO — CID 146594346
2,2-dimethyl-1-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]pent-3-en-1-amine (PubChem CID 146594346) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 2,2-dimethyl-1-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]pent-3-en-1-amine.
| Compound Name | 2,2-dimethyl-1-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]pent-3-en-1-amine |
|---|---|
| PubChem CID | 146594346 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 2,2-dimethyl-1-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]pent-3-en-1-amine |
| SMILES | CC=CC(C)(C)C(N)Oc1ccc(C(C)(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H31NO/c1-7-16-22(3,4)21(24)25-20-14-12-19(13-15-20)23(5,6)18-10-8-17(2)9-11-18/h7-16,21H,24H2,1-6H3 |
| InChIKey | XBEKNFLNIJRCEM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|