C25H29F2N7O4S2 — CID 146594397
3-(3,5-difluorophenyl)-2-[[2,3-dihydropyrrolo[2,3-b]pyridin-1-yl(methyl)amino]sulfanyloxycarbamoylamino]-N-(6-methoxy-3-pyridinyl)-N-methylpropanamide;sulfane (PubChem CID 146594397) has the molecular formula C25H29F2N7O4S2 and a molecular weight of 593.68 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-[[2,3-dihydropyrrolo[2,3-b]pyridin-1-yl(methyl)amino]sulfanyloxycarbamoylamino]-N-(6-methoxy-3-pyridinyl)-N-methylpropanamide;sulfane.
| Compound Name | 3-(3,5-difluorophenyl)-2-[[2,3-dihydropyrrolo[2,3-b]pyridin-1-yl(methyl)amino]sulfanyloxycarbamoylamino]-N-(6-methoxy-3-pyridinyl)-N-methylpropanamide;sulfane |
|---|---|
| PubChem CID | 146594397 |
| Molecular Formula | C25H29F2N7O4S2 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-[[2,3-dihydropyrrolo[2,3-b]pyridin-1-yl(methyl)amino]sulfanyloxycarbamoylamino]-N-(6-methoxy-3-pyridinyl)-N-methylpropanamide;sulfane |
| SMILES | COc1ccc(N(C)C(=O)C(Cc2cc(F)cc(F)c2)NC(=O)NOSN(C)N2CCc3cccnc32)cn1.S |
| InChI | InChI=1S/C25H27F2N7O4S.H2S/c1-32(20-6-7-22(37-3)29-15-20)24(35)21(13-16-11-18(26)14-19(27)12-16)30-25(36)31-38-39-33(2)34-10-8-17-5-4-9-28-23(17)34;/h4-7,9,11-12,14-15,21H,8,10,13H2,1-3H3,(H2,30,31,36);1H2 |
| InChIKey | RKDYRUKSENEYJC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|