C23H27F3N4O3S — CID 146594453
3-(3,5-difluorophenyl)-N-(3-fluoro-4-methoxyphenyl)-N-methyl-2-(piperidin-1-ylsulfanylcarbamoylamino)propanamide (PubChem CID 146594453) has the molecular formula C23H27F3N4O3S and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-N-(3-fluoro-4-methoxyphenyl)-N-methyl-2-(piperidin-1-ylsulfanylcarbamoylamino)propanamide.
| Compound Name | 3-(3,5-difluorophenyl)-N-(3-fluoro-4-methoxyphenyl)-N-methyl-2-(piperidin-1-ylsulfanylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 146594453 |
| Molecular Formula | C23H27F3N4O3S |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3-(3,5-difluorophenyl)-N-(3-fluoro-4-methoxyphenyl)-N-methyl-2-(piperidin-1-ylsulfanylcarbamoylamino)propanamide |
| SMILES | COc1ccc(N(C)C(=O)C(Cc2cc(F)cc(F)c2)NC(=O)NSN2CCCCC2)cc1F |
| InChI | InChI=1S/C23H27F3N4O3S/c1-29(18-6-7-21(33-2)19(26)14-18)22(31)20(12-15-10-16(24)13-17(25)11-15)27-23(32)28-34-30-8-4-3-5-9-30/h6-7,10-11,13-14,20H,3-5,8-9,12H2,1-2H3,(H2,27,28,32) |
| InChIKey | NHRYSVJHYLXWGY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|