C39H49ClN4O7S — CID 146596034
US11130769, Ex. No. 241 (PubChem CID 146596034) has the molecular formula C39H49ClN4O7S and a molecular weight of 753.36 g/mol.
| Compound Name | US11130769, Ex. No. 241 |
|---|---|
| PubChem CID | 146596034 |
| Molecular Formula | C39H49ClN4O7S |
| Molecular Weight | 753.36 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | — |
| SMILES | CN(C(=O)O[C@H]1/C=C/CN(C)C2(CCC2)C(=O)NS(=O)(=O)c2ccc3c(c2)N(C[C@@H]2CC[C@H]21)C[C@@]1(CCCc2cc(Cl)ccc21)CO3)[C@H]1CCOC1 |
| InChI | InChI=1S/C39H49ClN4O7S/c1-42-18-4-7-34(51-37(46)43(2)29-14-19-49-23-29)31-11-8-27(31)22-44-24-38(15-3-6-26-20-28(40)9-12-32(26)38)25-50-35-13-10-30(21-33(35)44)52(47,48)41-36(45)39(42)16-5-17-39/h4,7,9-10,12-13,20-21,27,29,31,34H,3,5-6,8,11,14-19,22-25H2,1-2H3,(H,41,45)/b7-4+/t27-,29-,31+,34-,38-/m0/s1 |
| InChIKey | AMMPHXUNVHUVQI-GZCMMHEFSA-N |
| XLogP | 5.29 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|