C16H15F2N3O6 — CID 146599178
[5-[3-(difluoromethyl)-4-nitropyrazol-1-yl]-1,3-dioxan-2-yl]methyl benzoate (PubChem CID 146599178) has the molecular formula C16H15F2N3O6 and a molecular weight of 383.31 g/mol. Its IUPAC name is [5-[3-(difluoromethyl)-4-nitropyrazol-1-yl]-1,3-dioxan-2-yl]methyl benzoate.
| Compound Name | [5-[3-(difluoromethyl)-4-nitropyrazol-1-yl]-1,3-dioxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 146599178 |
| Molecular Formula | C16H15F2N3O6 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [5-[3-(difluoromethyl)-4-nitropyrazol-1-yl]-1,3-dioxan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1OCC(n2cc([N+](=O)[O-])c(C(F)F)n2)CO1)c1ccccc1 |
| InChI | InChI=1S/C16H15F2N3O6/c17-15(18)14-12(21(23)24)6-20(19-14)11-7-25-13(26-8-11)9-27-16(22)10-4-2-1-3-5-10/h1-6,11,13,15H,7-9H2 |
| InChIKey | NFWUPXPTZDFCFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|