C23H27ClIN3O4S2 — CID 146599909
N-[[7-chloro-14-[(1-sulfanylpyrrolidin-3-yl)methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]sulfonyl]carbamoyl iodide (PubChem CID 146599909) has the molecular formula C23H27ClIN3O4S2 and a molecular weight of 635.98 g/mol. Its IUPAC name is N-[[7-chloro-14-[(1-sulfanylpyrrolidin-3-yl)methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]sulfonyl]carbamoyl iodide.
| Compound Name | N-[[7-chloro-14-[(1-sulfanylpyrrolidin-3-yl)methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]sulfonyl]carbamoyl iodide |
|---|---|
| PubChem CID | 146599909 |
| Molecular Formula | C23H27ClIN3O4S2 |
| Molecular Weight | 635.98 g/mol |
| Exact Mass | 635.02 |
| IUPAC Name | N-[[7-chloro-14-[(1-sulfanylpyrrolidin-3-yl)methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaen-17-yl]sulfonyl]carbamoyl iodide |
| SMILES | O=C(I)NS(=O)(=O)c1ccc2c(c1)N(CC1CCN(S)C1)CCCCc1cc(Cl)ccc1CO2 |
| InChI | InChI=1S/C23H27ClIN3O4S2/c24-19-5-4-18-15-32-22-7-6-20(34(30,31)26-23(25)29)12-21(22)27(9-2-1-3-17(18)11-19)13-16-8-10-28(33)14-16/h4-7,11-12,16,33H,1-3,8-10,13-15H2,(H,26,29) |
| InChIKey | MXMANWIWNWYGON-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.98 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|