C26H33ClN2O4S — CID 146599975
7-chloro-14-[[(1R,2R)-2-(prop-2-enoxymethyl)cyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-17-sulfonamide (PubChem CID 146599975) has the molecular formula C26H33ClN2O4S and a molecular weight of 505.08 g/mol. Its IUPAC name is 7-chloro-14-[[(1R,2R)-2-(prop-2-enoxymethyl)cyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-17-sulfonamide.
| Compound Name | 7-chloro-14-[[(1R,2R)-2-(prop-2-enoxymethyl)cyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-17-sulfonamide |
|---|---|
| PubChem CID | 146599975 |
| Molecular Formula | C26H33ClN2O4S |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 7-chloro-14-[[(1R,2R)-2-(prop-2-enoxymethyl)cyclobutyl]methyl]-2-oxa-14-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-17-sulfonamide |
| SMILES | C=CCOC[C@@H]1CC[C@H]1CN1CCCCc2cc(Cl)ccc2COc2ccc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C26H33ClN2O4S/c1-2-13-32-17-21-7-6-20(21)16-29-12-4-3-5-19-14-23(27)9-8-22(19)18-33-26-11-10-24(15-25(26)29)34(28,30)31/h2,8-11,14-15,20-21H,1,3-7,12-13,16-18H2,(H2,28,30,31)/t20-,21-/m0/s1 |
| InChIKey | MLRKJQFTCMBLHY-SFTDATJTSA-N |
| XLogP | 4.94 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|