C27H32ClNO3 — CID 149085769
methyl 7-chloro-2-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]-14-oxa-2-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-18-carboxylate (PubChem CID 149085769) has the molecular formula C27H32ClNO3 and a molecular weight of 454.01 g/mol. Its IUPAC name is methyl 7-chloro-2-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]-14-oxa-2-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-18-carboxylate.
| Compound Name | methyl 7-chloro-2-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]-14-oxa-2-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-18-carboxylate |
|---|---|
| PubChem CID | 149085769 |
| Molecular Formula | C27H32ClNO3 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | methyl 7-chloro-2-[[(1R,2S)-2-prop-2-enylcyclobutyl]methyl]-14-oxa-2-azatricyclo[13.4.0.04,9]nonadeca-1(15),4(9),5,7,16,18-hexaene-18-carboxylate |
| SMILES | C=CC[C@@H]1CC[C@H]1CN1Cc2ccc(Cl)cc2CCCCOc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C27H32ClNO3/c1-3-6-19-8-9-22(19)17-29-18-23-10-12-24(28)15-20(23)7-4-5-14-32-26-13-11-21(16-25(26)29)27(30)31-2/h3,10-13,15-16,19,22H,1,4-9,14,17-18H2,2H3/t19-,22+/m1/s1 |
| InChIKey | QRFKLUNOBPGKPA-KNQAVFIVSA-N |
| XLogP | 6.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|