C25H26ClNO5 — CID 158938532
methyl (4S)-7-chloro-5'-[[(1R,2R)-2-formylcyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 158938532) has the molecular formula C25H26ClNO5 and a molecular weight of 455.94 g/mol. Its IUPAC name is methyl (4S)-7-chloro-5'-[[(1R,2R)-2-formylcyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | methyl (4S)-7-chloro-5'-[[(1R,2R)-2-formylcyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 158938532 |
| Molecular Formula | C25H26ClNO5 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | methyl (4S)-7-chloro-5'-[[(1R,2R)-2-formylcyclobutyl]methyl]spiro[2,3-dihydrochromene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)N(C[C@@H]1CC[C@H]1C=O)C[C@@]1(CCOc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C25H26ClNO5/c1-30-24(29)16-4-7-22-21(10-16)27(12-17-2-3-18(17)13-28)14-25(15-32-22)8-9-31-23-11-19(26)5-6-20(23)25/h4-7,10-11,13,17-18H,2-3,8-9,12,14-15H2,1H3/t17-,18-,25-/m0/s1 |
| InChIKey | JJYKIGRIGCFLTA-RPPIVITFSA-N |
| XLogP | 4.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|