C27H30ClNO4 — CID 166665854
7-chloro-5'-[[(1R,2R)-2-[(E)-2-methoxyethenyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid (PubChem CID 166665854) has the molecular formula C27H30ClNO4 and a molecular weight of 467.99 g/mol. Its IUPAC name is 7-chloro-5'-[[(1R,2R)-2-[(E)-2-methoxyethenyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid.
| Compound Name | 7-chloro-5'-[[(1R,2R)-2-[(E)-2-methoxyethenyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
|---|---|
| PubChem CID | 166665854 |
| Molecular Formula | C27H30ClNO4 |
| Molecular Weight | 467.99 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 7-chloro-5'-[[(1R,2R)-2-[(E)-2-methoxyethenyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
| SMILES | CO/C=C/[C@@H]1CC[C@H]1CN1CC2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C27H30ClNO4/c1-32-12-10-18-4-5-21(18)15-29-16-27(11-2-3-19-13-22(28)7-8-23(19)27)17-33-25-9-6-20(26(30)31)14-24(25)29/h6-10,12-14,18,21H,2-5,11,15-17H2,1H3,(H,30,31)/b12-10+/t18-,21-,27?/m0/s1 |
| InChIKey | MTTGYYQZFSEAKS-PVGOAFIZSA-N |
| XLogP | 5.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.99 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|