C33H40ClNO5 — CID 162159072
tert-butyl (4S)-7-chloro-5'-[[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 162159072) has the molecular formula C33H40ClNO5 and a molecular weight of 566.14 g/mol. Its IUPAC name is tert-butyl (4S)-7-chloro-5'-[[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | tert-butyl (4S)-7-chloro-5'-[[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 162159072 |
| Molecular Formula | C33H40ClNO5 |
| Molecular Weight | 566.14 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | tert-butyl (4S)-7-chloro-5'-[[(1R,2S)-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]cyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1CC[C@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C33H40ClNO5/c1-5-38-30(36)15-11-22-8-9-25(22)19-35-20-33(16-6-7-23-17-26(34)12-13-27(23)33)21-39-29-14-10-24(18-28(29)35)31(37)40-32(2,3)4/h10-15,17-18,22,25H,5-9,16,19-21H2,1-4H3/b15-11+/t22-,25-,33-/m0/s1 |
| InChIKey | ZMFNSDLHIKEYFR-ISJYTRJMSA-N |
| XLogP | 6.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.14 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|