C30H36ClNO4 — CID 166665404
tert-butyl 7-chloro-5'-[[(1R,2R)-2-formyl-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 166665404) has the molecular formula C30H36ClNO4 and a molecular weight of 510.07 g/mol. Its IUPAC name is tert-butyl 7-chloro-5'-[[(1R,2R)-2-formyl-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | tert-butyl 7-chloro-5'-[[(1R,2R)-2-formyl-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 166665404 |
| Molecular Formula | C30H36ClNO4 |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | tert-butyl 7-chloro-5'-[[(1R,2R)-2-formyl-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2c(c1)N(C[C@@H]1CC[C@@]1(C)C=O)CC1(CCCc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C30H36ClNO4/c1-28(2,3)36-27(34)21-7-10-26-25(15-21)32(16-22-11-13-29(22,4)18-33)17-30(19-35-26)12-5-6-20-14-23(31)8-9-24(20)30/h7-10,14-15,18,22H,5-6,11-13,16-17,19H2,1-4H3/t22-,29-,30?/m0/s1 |
| InChIKey | YDYVVRPIPJDADO-JWPPRTFLSA-N |
| XLogP | 6.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|