C28H32ClNO4 — CID 166665197
7-chloro-5'-[[(1S,2S)-2-(1-hydroxyprop-2-enyl)-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid (PubChem CID 166665197) has the molecular formula C28H32ClNO4 and a molecular weight of 482.02 g/mol. Its IUPAC name is 7-chloro-5'-[[(1S,2S)-2-(1-hydroxyprop-2-enyl)-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid.
| Compound Name | 7-chloro-5'-[[(1S,2S)-2-(1-hydroxyprop-2-enyl)-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
|---|---|
| PubChem CID | 166665197 |
| Molecular Formula | C28H32ClNO4 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 7-chloro-5'-[[(1S,2S)-2-(1-hydroxyprop-2-enyl)-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylic acid |
| SMILES | C=CC(O)[C@@]1(C)CC[C@@H]1CN1CC2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C28H32ClNO4/c1-3-25(31)27(2)12-10-20(27)15-30-16-28(11-4-5-18-13-21(29)7-8-22(18)28)17-34-24-9-6-19(26(32)33)14-23(24)30/h3,6-9,13-14,20,25,31H,1,4-5,10-12,15-17H2,2H3,(H,32,33)/t20-,25?,27+,28?/m1/s1 |
| InChIKey | GERVBRVJBKBXBX-HMFGMBJZSA-N |
| XLogP | 5.47 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|