C32H40ClNO4 — CID 166665190
tert-butyl 7-chloro-5'-[[(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 166665190) has the molecular formula C32H40ClNO4 and a molecular weight of 538.13 g/mol. Its IUPAC name is tert-butyl 7-chloro-5'-[[(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | tert-butyl 7-chloro-5'-[[(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 166665190 |
| Molecular Formula | C32H40ClNO4 |
| Molecular Weight | 538.13 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | tert-butyl 7-chloro-5'-[[(1S,2S)-2-[(1R)-1-hydroxyprop-2-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | C=C[C@@H](O)[C@@]1(C)CC[C@@H]1CN1CC2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C32H40ClNO4/c1-6-28(35)31(5)15-13-23(31)18-34-19-32(14-7-8-21-16-24(33)10-11-25(21)32)20-37-27-12-9-22(17-26(27)34)29(36)38-30(2,3)4/h6,9-12,16-17,23,28,35H,1,7-8,13-15,18-20H2,2-5H3/t23-,28-,31+,32?/m1/s1 |
| InChIKey | JYTMPBGZHGJLKG-MTVLXILDSA-N |
| XLogP | 6.73 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.13 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|